C27H34N4O2 — CID 68827394
5-[(3-methoxypropylamino)methyl]-7-[5-(piperidin-1-ylmethyl)-1H-indol-2-yl]-2,3-dihydroisoindol-1-one (PubChem CID 68827394) has the molecular formula C27H34N4O2 and a molecular weight of 446.60 g/mol. Its IUPAC name is 5-[(3-methoxypropylamino)methyl]-7-[5-(piperidin-1-ylmethyl)-1H-indol-2-yl]-2,3-dihydroisoindol-1-one.
| Compound Name | 5-[(3-methoxypropylamino)methyl]-7-[5-(piperidin-1-ylmethyl)-1H-indol-2-yl]-2,3-dihydroisoindol-1-one |
|---|---|
| PubChem CID | 68827394 |
| Molecular Formula | C27H34N4O2 |
| Molecular Weight | 446.60 g/mol |
| Exact Mass | 446.27 |
| IUPAC Name | 5-[(3-methoxypropylamino)methyl]-7-[5-(piperidin-1-ylmethyl)-1H-indol-2-yl]-2,3-dihydroisoindol-1-one |
| SMILES | COCCCNCc1cc2c(c(-c3cc4cc(CN5CCCCC5)ccc4[nH]3)c1)C(=O)NC2 |
| InChI | InChI=1S/C27H34N4O2/c1-33-11-5-8-28-16-20-13-22-17-29-27(32)26(22)23(14-20)25-15-21-12-19(6-7-24(21)30-25)18-31-9-3-2-4-10-31/h6-7,12-15,28,30H,2-5,8-11,16-18H2,1H3,(H,29,32) |
| InChIKey | IMQYZEXSVLVOOS-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 69.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.60 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|