C23H24ClN3O4S — CID 87471219
[1-oxo-7-[5-(piperidin-1-ylmethyl)-1H-indol-2-yl]-2,3-dihydroisoindol-4-yl] chloromethanesulfonate (PubChem CID 87471219) has the molecular formula C23H24ClN3O4S and a molecular weight of 473.98 g/mol. Its IUPAC name is [1-oxo-7-[5-(piperidin-1-ylmethyl)-1H-indol-2-yl]-2,3-dihydroisoindol-4-yl] chloromethanesulfonate.
| Compound Name | [1-oxo-7-[5-(piperidin-1-ylmethyl)-1H-indol-2-yl]-2,3-dihydroisoindol-4-yl] chloromethanesulfonate |
|---|---|
| PubChem CID | 87471219 |
| Molecular Formula | C23H24ClN3O4S |
| Molecular Weight | 473.98 g/mol |
| Exact Mass | 473.12 |
| IUPAC Name | [1-oxo-7-[5-(piperidin-1-ylmethyl)-1H-indol-2-yl]-2,3-dihydroisoindol-4-yl] chloromethanesulfonate |
| SMILES | O=C1NCc2c(OS(=O)(=O)CCl)ccc(-c3cc4cc(CN5CCCCC5)ccc4[nH]3)c21 |
| InChI | InChI=1S/C23H24ClN3O4S/c24-14-32(29,30)31-21-7-5-17(22-18(21)12-25-23(22)28)20-11-16-10-15(4-6-19(16)26-20)13-27-8-2-1-3-9-27/h4-7,10-11,26H,1-3,8-9,12-14H2,(H,25,28) |
| InChIKey | YZUAGFGXKRJZDO-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 91.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.98 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|