C26H32ClN3O7S — CID 87471487
[7-[5-[(4,4-dimethoxypiperidin-1-yl)methyl]-1H-indol-2-yl]-5-methoxy-1-oxo-2,3-dihydroisoindol-4-yl] methanesulfonate;hydrochloride (PubChem CID 87471487) has the molecular formula C26H32ClN3O7S and a molecular weight of 566.08 g/mol. Its IUPAC name is [7-[5-[(4,4-dimethoxypiperidin-1-yl)methyl]-1H-indol-2-yl]-5-methoxy-1-oxo-2,3-dihydroisoindol-4-yl] methanesulfonate;hydrochloride.
| Compound Name | [7-[5-[(4,4-dimethoxypiperidin-1-yl)methyl]-1H-indol-2-yl]-5-methoxy-1-oxo-2,3-dihydroisoindol-4-yl] methanesulfonate;hydrochloride |
|---|---|
| PubChem CID | 87471487 |
| Molecular Formula | C26H32ClN3O7S |
| Molecular Weight | 566.08 g/mol |
| Exact Mass | 565.16 |
| IUPAC Name | [7-[5-[(4,4-dimethoxypiperidin-1-yl)methyl]-1H-indol-2-yl]-5-methoxy-1-oxo-2,3-dihydroisoindol-4-yl] methanesulfonate;hydrochloride |
| SMILES | COc1cc(-c2cc3cc(CN4CCC(OC)(OC)CC4)ccc3[nH]2)c2c(c1OS(C)(=O)=O)CNC2=O.Cl |
| InChI | InChI=1S/C26H31N3O7S.ClH/c1-33-22-13-18(23-19(14-27-25(23)30)24(22)36-37(4,31)32)21-12-17-11-16(5-6-20(17)28-21)15-29-9-7-26(34-2,35-3)8-10-29;/h5-6,11-13,28H,7-10,14-15H2,1-4H3,(H,27,30);1H |
| InChIKey | OXNPNILFNCSYSM-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 119.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.08 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|