C28H27N3O4S — CID 46215192
[1-oxo-7-[5-(piperidin-1-ylmethyl)-1H-indol-2-yl]-2,3-dihydroisoindol-4-yl] benzenesulfonate (PubChem CID 46215192) has the molecular formula C28H27N3O4S and a molecular weight of 501.61 g/mol. Its IUPAC name is [1-oxo-7-[5-(piperidin-1-ylmethyl)-1H-indol-2-yl]-2,3-dihydroisoindol-4-yl] benzenesulfonate.
| Compound Name | [1-oxo-7-[5-(piperidin-1-ylmethyl)-1H-indol-2-yl]-2,3-dihydroisoindol-4-yl] benzenesulfonate |
|---|---|
| PubChem CID | 46215192 |
| Molecular Formula | C28H27N3O4S |
| Molecular Weight | 501.61 g/mol |
| Exact Mass | 501.17 |
| IUPAC Name | [1-oxo-7-[5-(piperidin-1-ylmethyl)-1H-indol-2-yl]-2,3-dihydroisoindol-4-yl] benzenesulfonate |
| SMILES | O=C1NCc2c(OS(=O)(=O)c3ccccc3)ccc(-c3cc4cc(CN5CCCCC5)ccc4[nH]3)c21 |
| InChI | InChI=1S/C28H27N3O4S/c32-28-27-22(10-12-26(23(27)17-29-28)35-36(33,34)21-7-3-1-4-8-21)25-16-20-15-19(9-11-24(20)30-25)18-31-13-5-2-6-14-31/h1,3-4,7-12,15-16,30H,2,5-6,13-14,17-18H2,(H,29,32) |
| InChIKey | YGRYMOMEFAYCMO-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 91.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.61 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|