C18H22BrCl2N3O4S — CID 142264030
N-[5-bromo-3-[(Z)-4-methoxy-2-methylbut-3-enoxy]pyrazin-2-yl]-2,3-dichlorobenzenesulfonamide;ethane (PubChem CID 142264030) has the molecular formula C18H22BrCl2N3O4S and a molecular weight of 527.27 g/mol. Its IUPAC name is N-[5-bromo-3-[(Z)-4-methoxy-2-methylbut-3-enoxy]pyrazin-2-yl]-2,3-dichlorobenzenesulfonamide;ethane.
| Compound Name | N-[5-bromo-3-[(Z)-4-methoxy-2-methylbut-3-enoxy]pyrazin-2-yl]-2,3-dichlorobenzenesulfonamide;ethane |
|---|---|
| PubChem CID | 142264030 |
| Molecular Formula | C18H22BrCl2N3O4S |
| Molecular Weight | 527.27 g/mol |
| Exact Mass | 524.99 |
| IUPAC Name | N-[5-bromo-3-[(Z)-4-methoxy-2-methylbut-3-enoxy]pyrazin-2-yl]-2,3-dichlorobenzenesulfonamide;ethane |
| SMILES | CC.CO/C=C\C(C)COc1nc(Br)cnc1NS(=O)(=O)c1cccc(Cl)c1Cl |
| InChI | InChI=1S/C16H16BrCl2N3O4S.C2H6/c1-10(6-7-25-2)9-26-16-15(20-8-13(17)21-16)22-27(23,24)12-5-3-4-11(18)14(12)19;1-2/h3-8,10H,9H2,1-2H3,(H,20,22);1-2H3/b7-6-; |
| InChIKey | VCESUCMXADENDL-NAFXZHHSSA-N |
| XLogP | 5.55 |
| TPSA | 90.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.27 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|