C18H14BCl2N3O4S — CID 88884945
CID 88884945 (PubChem CID 88884945) has the molecular formula C18H14BCl2N3O4S and a molecular weight of 450.11 g/mol.
| Compound Name | CID 88884945 |
|---|---|
| PubChem CID | 88884945 |
| Molecular Formula | C18H14BCl2N3O4S |
| Molecular Weight | 450.11 g/mol |
| Exact Mass | 449.02 |
| IUPAC Name | — |
| SMILES | [B]c1cnc(NS(=O)(=O)c2cccc(Cl)c2Cl)c(OCCOc2ccccc2)n1 |
| InChI | InChI=1S/C18H14BCl2N3O4S/c19-15-11-22-17(24-29(25,26)14-8-4-7-13(20)16(14)21)18(23-15)28-10-9-27-12-5-2-1-3-6-12/h1-8,11H,9-10H2,(H,22,24) |
| InChIKey | OSKVCPAIKLTLLL-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 90.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.11 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|