C24H21ClN2O4S — CID 23122496
3-chloro-2-methyl-N-[2-(2-phenoxyethoxy)quinolin-3-yl]benzenesulfonamide (PubChem CID 23122496) has the molecular formula C24H21ClN2O4S and a molecular weight of 468.96 g/mol. Its IUPAC name is 3-chloro-2-methyl-N-[2-(2-phenoxyethoxy)quinolin-3-yl]benzenesulfonamide.
| Compound Name | 3-chloro-2-methyl-N-[2-(2-phenoxyethoxy)quinolin-3-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 23122496 |
| Molecular Formula | C24H21ClN2O4S |
| Molecular Weight | 468.96 g/mol |
| Exact Mass | 468.09 |
| IUPAC Name | 3-chloro-2-methyl-N-[2-(2-phenoxyethoxy)quinolin-3-yl]benzenesulfonamide |
| SMILES | Cc1c(Cl)cccc1S(=O)(=O)Nc1cc2ccccc2nc1OCCOc1ccccc1 |
| InChI | InChI=1S/C24H21ClN2O4S/c1-17-20(25)11-7-13-23(17)32(28,29)27-22-16-18-8-5-6-12-21(18)26-24(22)31-15-14-30-19-9-3-2-4-10-19/h2-13,16,27H,14-15H2,1H3 |
| InChIKey | FNOVCYMQTPOWDC-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 77.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.96 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|