C18H18F3N3O — CID 142264646
2-methylbutan-1-imine;2-oxo-6-phenyl-4-(trifluoromethyl)-1H-pyridine-3-carbonitrile (PubChem CID 142264646) has the molecular formula C18H18F3N3O and a molecular weight of 349.36 g/mol. Its IUPAC name is 2-methylbutan-1-imine;2-oxo-6-phenyl-4-(trifluoromethyl)-1H-pyridine-3-carbonitrile.
| Compound Name | 2-methylbutan-1-imine;2-oxo-6-phenyl-4-(trifluoromethyl)-1H-pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 142264646 |
| Molecular Formula | C18H18F3N3O |
| Molecular Weight | 349.36 g/mol |
| Exact Mass | 349.14 |
| IUPAC Name | 2-methylbutan-1-imine;2-oxo-6-phenyl-4-(trifluoromethyl)-1H-pyridine-3-carbonitrile |
| SMILES | N#Cc1c(C(F)(F)F)cc(-c2ccccc2)[nH]c1=O.[H]/N=C/C(C)CC |
| InChI | InChI=1S/C13H7F3N2O.C5H11N/c14-13(15,16)10-6-11(8-4-2-1-3-5-8)18-12(19)9(10)7-17;1-3-5(2)4-6/h1-6H,(H,18,19);4-6H,3H2,1-2H3/b;6-4+ |
| InChIKey | IWEPFCKWQMBVMC-DVXCEAISSA-N |
| XLogP | 4.61 |
| TPSA | 80.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.36 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|