C20H27ClN2O — CID 142311064
4-tert-butyl-6-(4-chlorophenyl)-2-oxo-1H-pyridine-3-carbonitrile;ethane (PubChem CID 142311064) has the molecular formula C20H27ClN2O and a molecular weight of 346.90 g/mol. Its IUPAC name is 4-tert-butyl-6-(4-chlorophenyl)-2-oxo-1H-pyridine-3-carbonitrile;ethane.
| Compound Name | 4-tert-butyl-6-(4-chlorophenyl)-2-oxo-1H-pyridine-3-carbonitrile;ethane |
|---|---|
| PubChem CID | 142311064 |
| Molecular Formula | C20H27ClN2O |
| Molecular Weight | 346.90 g/mol |
| Exact Mass | 346.18 |
| IUPAC Name | 4-tert-butyl-6-(4-chlorophenyl)-2-oxo-1H-pyridine-3-carbonitrile;ethane |
| SMILES | CC.CC.CC(C)(C)c1cc(-c2ccc(Cl)cc2)[nH]c(=O)c1C#N |
| InChI | InChI=1S/C16H15ClN2O.2C2H6/c1-16(2,3)13-8-14(19-15(20)12(13)9-18)10-4-6-11(17)7-5-10;2*1-2/h4-8H,1-3H3,(H,19,20);2*1-2H3 |
| InChIKey | XOFJJRZHNKSDFM-UHFFFAOYSA-N |
| XLogP | 5.92 |
| TPSA | 56.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.90 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |