C20H13ClN2O4 — CID 10619808
methyl 5-[6-(4-chlorophenyl)-3-cyano-2-oxo-1H-pyridin-4-yl]-2-hydroxybenzoate (PubChem CID 10619808) has the molecular formula C20H13ClN2O4 and a molecular weight of 380.79 g/mol. Its IUPAC name is methyl 5-[6-(4-chlorophenyl)-3-cyano-2-oxo-1H-pyridin-4-yl]-2-hydroxybenzoate.
| Compound Name | methyl 5-[6-(4-chlorophenyl)-3-cyano-2-oxo-1H-pyridin-4-yl]-2-hydroxybenzoate |
|---|---|
| PubChem CID | 10619808 |
| Molecular Formula | C20H13ClN2O4 |
| Molecular Weight | 380.79 g/mol |
| Exact Mass | 380.06 |
| IUPAC Name | methyl 5-[6-(4-chlorophenyl)-3-cyano-2-oxo-1H-pyridin-4-yl]-2-hydroxybenzoate |
| SMILES | COC(=O)c1cc(-c2cc(-c3ccc(Cl)cc3)[nH]c(=O)c2C#N)ccc1O |
| InChI | InChI=1S/C20H13ClN2O4/c1-27-20(26)15-8-12(4-7-18(15)24)14-9-17(23-19(25)16(14)10-22)11-2-5-13(21)6-3-11/h2-9,24H,1H3,(H,23,25) |
| InChIKey | BNGJNIAFTRCKFS-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 103.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.79 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |