C30H31NO5 — CID 142265007
2-hydroxy-2-[(3-methoxyphenyl)methyl]-4-methyl-N-(1-oxo-3H-2-benzofuran-5-yl)-4-phenylhept-6-enamide (PubChem CID 142265007) has the molecular formula C30H31NO5 and a molecular weight of 485.58 g/mol. Its IUPAC name is 2-hydroxy-2-[(3-methoxyphenyl)methyl]-4-methyl-N-(1-oxo-3H-2-benzofuran-5-yl)-4-phenylhept-6-enamide.
| Compound Name | 2-hydroxy-2-[(3-methoxyphenyl)methyl]-4-methyl-N-(1-oxo-3H-2-benzofuran-5-yl)-4-phenylhept-6-enamide |
|---|---|
| PubChem CID | 142265007 |
| Molecular Formula | C30H31NO5 |
| Molecular Weight | 485.58 g/mol |
| Exact Mass | 485.22 |
| IUPAC Name | 2-hydroxy-2-[(3-methoxyphenyl)methyl]-4-methyl-N-(1-oxo-3H-2-benzofuran-5-yl)-4-phenylhept-6-enamide |
| SMILES | C=CCC(C)(CC(O)(Cc1cccc(OC)c1)C(=O)Nc1ccc2c(c1)COC2=O)c1ccccc1 |
| InChI | InChI=1S/C30H31NO5/c1-4-15-29(2,23-10-6-5-7-11-23)20-30(34,18-21-9-8-12-25(16-21)35-3)28(33)31-24-13-14-26-22(17-24)19-36-27(26)32/h4-14,16-17,34H,1,15,18-20H2,2-3H3,(H,31,33) |
| InChIKey | VFQBJCFKPVIIGT-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.58 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|