C24H25NO5 — CID 15949907
2,6-dihydroxy-2-(2-methyl-2-phenylpropyl)-N-(1-oxo-3H-2-benzofuran-5-yl)hex-3-ynamide (PubChem CID 15949907) has the molecular formula C24H25NO5 and a molecular weight of 407.47 g/mol. Its IUPAC name is 2,6-dihydroxy-2-(2-methyl-2-phenylpropyl)-N-(1-oxo-3H-2-benzofuran-5-yl)hex-3-ynamide.
| Compound Name | 2,6-dihydroxy-2-(2-methyl-2-phenylpropyl)-N-(1-oxo-3H-2-benzofuran-5-yl)hex-3-ynamide |
|---|---|
| PubChem CID | 15949907 |
| Molecular Formula | C24H25NO5 |
| Molecular Weight | 407.47 g/mol |
| Exact Mass | 407.17 |
| IUPAC Name | 2,6-dihydroxy-2-(2-methyl-2-phenylpropyl)-N-(1-oxo-3H-2-benzofuran-5-yl)hex-3-ynamide |
| SMILES | CC(C)(CC(O)(C#CCCO)C(=O)Nc1ccc2c(c1)COC2=O)c1ccccc1 |
| InChI | InChI=1S/C24H25NO5/c1-23(2,18-8-4-3-5-9-18)16-24(29,12-6-7-13-26)22(28)25-19-10-11-20-17(14-19)15-30-21(20)27/h3-5,8-11,14,26,29H,7,13,15-16H2,1-2H3,(H,25,28) |
| InChIKey | JZVILYYHDQFKGJ-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 95.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.47 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|