C24H24ClN7S — CID 142265213
2-N-[3-chloro-4-(diethylamino)phenyl]-4-N-(6-methyl-1H-indazol-5-yl)thieno[3,2-d]pyrimidine-2,4-diamine (PubChem CID 142265213) has the molecular formula C24H24ClN7S and a molecular weight of 478.03 g/mol. Its IUPAC name is 2-N-[3-chloro-4-(diethylamino)phenyl]-4-N-(6-methyl-1H-indazol-5-yl)thieno[3,2-d]pyrimidine-2,4-diamine.
| Compound Name | 2-N-[3-chloro-4-(diethylamino)phenyl]-4-N-(6-methyl-1H-indazol-5-yl)thieno[3,2-d]pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 142265213 |
| Molecular Formula | C24H24ClN7S |
| Molecular Weight | 478.03 g/mol |
| Exact Mass | 477.15 |
| IUPAC Name | 2-N-[3-chloro-4-(diethylamino)phenyl]-4-N-(6-methyl-1H-indazol-5-yl)thieno[3,2-d]pyrimidine-2,4-diamine |
| SMILES | CCN(CC)c1ccc(Nc2nc(Nc3cc4cn[nH]c4cc3C)c3sccc3n2)cc1Cl |
| InChI | InChI=1S/C24H24ClN7S/c1-4-32(5-2)21-7-6-16(12-17(21)25)27-24-29-18-8-9-33-22(18)23(30-24)28-19-11-15-13-26-31-20(15)10-14(19)3/h6-13H,4-5H2,1-3H3,(H,26,31)(H2,27,28,29,30) |
| InChIKey | KMGUDLBHZSDGFD-UHFFFAOYSA-N |
| XLogP | 6.86 |
| TPSA | 81.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.03 |
| LogP ≤ 5 | 6.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|