C10H16FN3 — CID 142265865
3-(4-fluorocyclohexyl)-4,5-dimethyl-1,2,4-triazole (PubChem CID 142265865) has the molecular formula C10H16FN3 and a molecular weight of 197.26 g/mol. Its IUPAC name is 3-(4-fluorocyclohexyl)-4,5-dimethyl-1,2,4-triazole.
| Compound Name | 3-(4-fluorocyclohexyl)-4,5-dimethyl-1,2,4-triazole |
|---|---|
| PubChem CID | 142265865 |
| Molecular Formula | C10H16FN3 |
| Molecular Weight | 197.26 g/mol |
| Exact Mass | 197.13 |
| IUPAC Name | 3-(4-fluorocyclohexyl)-4,5-dimethyl-1,2,4-triazole |
| SMILES | Cc1nnc(C2CCC(F)CC2)n1C |
| InChI | InChI=1S/C10H16FN3/c1-7-12-13-10(14(7)2)8-3-5-9(11)6-4-8/h8-9H,3-6H2,1-2H3 |
| InChIKey | WMWRAGJLZPWCPO-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.26 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |