C11H17F2N3 — CID 170928371
3-(difluoromethyl)-7-(2-methylpropyl)-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridine (PubChem CID 170928371) has the molecular formula C11H17F2N3 and a molecular weight of 229.27 g/mol. Its IUPAC name is 3-(difluoromethyl)-7-(2-methylpropyl)-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridine.
| Compound Name | 3-(difluoromethyl)-7-(2-methylpropyl)-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridine |
|---|---|
| PubChem CID | 170928371 |
| Molecular Formula | C11H17F2N3 |
| Molecular Weight | 229.27 g/mol |
| Exact Mass | 229.14 |
| IUPAC Name | 3-(difluoromethyl)-7-(2-methylpropyl)-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridine |
| SMILES | CC(C)CC1CCn2c(nnc2C(F)F)C1 |
| InChI | InChI=1S/C11H17F2N3/c1-7(2)5-8-3-4-16-9(6-8)14-15-11(16)10(12)13/h7-8,10H,3-6H2,1-2H3 |
| InChIKey | LGXGRDJFZDKFKU-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.27 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |