C20H23F2N3S — CID 142265927
N-[[(Z)-2-[4-[[(E)-but-2-enyl]amino]phenyl]-2-(methylamino)ethenyl]sulfanylmethyl]-2,4-difluoroaniline (PubChem CID 142265927) has the molecular formula C20H23F2N3S and a molecular weight of 375.49 g/mol. Its IUPAC name is N-[[(Z)-2-[4-[[(E)-but-2-enyl]amino]phenyl]-2-(methylamino)ethenyl]sulfanylmethyl]-2,4-difluoroaniline.
| Compound Name | N-[[(Z)-2-[4-[[(E)-but-2-enyl]amino]phenyl]-2-(methylamino)ethenyl]sulfanylmethyl]-2,4-difluoroaniline |
|---|---|
| PubChem CID | 142265927 |
| Molecular Formula | C20H23F2N3S |
| Molecular Weight | 375.49 g/mol |
| Exact Mass | 375.16 |
| IUPAC Name | N-[[(Z)-2-[4-[[(E)-but-2-enyl]amino]phenyl]-2-(methylamino)ethenyl]sulfanylmethyl]-2,4-difluoroaniline |
| SMILES | C/C=C/CNc1ccc(/C(=C/SCNc2ccc(F)cc2F)NC)cc1 |
| InChI | InChI=1S/C20H23F2N3S/c1-3-4-11-24-17-8-5-15(6-9-17)20(23-2)13-26-14-25-19-10-7-16(21)12-18(19)22/h3-10,12-13,23-25H,11,14H2,1-2H3/b4-3+,20-13- |
| InChIKey | QJNZCOYOMPIBGW-RCJVQLFLSA-N |
| XLogP | 5.27 |
| TPSA | 36.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.49 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|