C36H36N4O3 — CID 142266224
(2Z)-2-(aminomethylidene)-4-[(4-methoxyphenyl)methyl]-5-methylmorpholin-3-one;1-tritylimidazole (PubChem CID 142266224) has the molecular formula C36H36N4O3 and a molecular weight of 572.71 g/mol. Its IUPAC name is (2Z)-2-(aminomethylidene)-4-[(4-methoxyphenyl)methyl]-5-methylmorpholin-3-one;1-tritylimidazole.
| Compound Name | (2Z)-2-(aminomethylidene)-4-[(4-methoxyphenyl)methyl]-5-methylmorpholin-3-one;1-tritylimidazole |
|---|---|
| PubChem CID | 142266224 |
| Molecular Formula | C36H36N4O3 |
| Molecular Weight | 572.71 g/mol |
| Exact Mass | 572.28 |
| IUPAC Name | (2Z)-2-(aminomethylidene)-4-[(4-methoxyphenyl)methyl]-5-methylmorpholin-3-one;1-tritylimidazole |
| SMILES | COc1ccc(CN2C(=O)/C(=C/N)OCC2C)cc1.c1ccc(C(c2ccccc2)(c2ccccc2)n2ccnc2)cc1 |
| InChI | InChI=1S/C22H18N2.C14H18N2O3/c1-4-10-19(11-5-1)22(24-17-16-23-18-24,20-12-6-2-7-13-20)21-14-8-3-9-15-21;1-10-9-19-13(7-15)14(17)16(10)8-11-3-5-12(18-2)6-4-11/h1-18H;3-7,10H,8-9,15H2,1-2H3/b;13-7- |
| InChIKey | RYWJILKPYLAKCY-LWKUWLFASA-N |
| XLogP | 5.97 |
| TPSA | 82.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.71 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|