C29H36F6N2O2 — CID 142266532
N-[2,5-bis(trifluoromethyl)phenyl]-3a,7-dimethyl-7-[(Z)-3-(methylamino)-3-oxoprop-1-enyl]-1,2,3,4,5,6,6a,8,9,10,10a,10b-dodecahydrobenzo[e]azulene-3-carboxamide (PubChem CID 142266532) has the molecular formula C29H36F6N2O2 and a molecular weight of 558.61 g/mol. Its IUPAC name is N-[2,5-bis(trifluoromethyl)phenyl]-3a,7-dimethyl-7-[(Z)-3-(methylamino)-3-oxoprop-1-enyl]-1,2,3,4,5,6,6a,8,9,10,10a,10b-dodecahydrobenzo[e]azulene-3-carboxamide.
| Compound Name | N-[2,5-bis(trifluoromethyl)phenyl]-3a,7-dimethyl-7-[(Z)-3-(methylamino)-3-oxoprop-1-enyl]-1,2,3,4,5,6,6a,8,9,10,10a,10b-dodecahydrobenzo[e]azulene-3-carboxamide |
|---|---|
| PubChem CID | 142266532 |
| Molecular Formula | C29H36F6N2O2 |
| Molecular Weight | 558.61 g/mol |
| Exact Mass | 558.27 |
| IUPAC Name | N-[2,5-bis(trifluoromethyl)phenyl]-3a,7-dimethyl-7-[(Z)-3-(methylamino)-3-oxoprop-1-enyl]-1,2,3,4,5,6,6a,8,9,10,10a,10b-dodecahydrobenzo[e]azulene-3-carboxamide |
| SMILES | CNC(=O)/C=C\C1(C)CCCC2C1CCCC1(C)C(C(=O)Nc3cc(C(F)(F)F)ccc3C(F)(F)F)CCC21 |
| InChI | InChI=1S/C29H36F6N2O2/c1-26(15-12-24(38)36-3)13-4-6-18-19(26)7-5-14-27(2)20(18)10-11-22(27)25(39)37-23-16-17(28(30,31)32)8-9-21(23)29(33,34)35/h8-9,12,15-16,18-20,22H,4-7,10-11,13-14H2,1-3H3,(H,36,38)(H,37,39)/b15-12- |
| InChIKey | WEOGSOMJEQFZJB-QINSGFPZSA-N |
| XLogP | 7.60 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.61 |
| LogP ≤ 5 | 7.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|