C23H32F3NO — CID 142266534
5-ethyl-6,8a-dimethyl-N-[5-methyl-2-(trifluoromethyl)phenyl]-2,3,3a,4,5,6,7,8-octahydro-1H-azulene-1-carboxamide (PubChem CID 142266534) has the molecular formula C23H32F3NO and a molecular weight of 395.51 g/mol. Its IUPAC name is 5-ethyl-6,8a-dimethyl-N-[5-methyl-2-(trifluoromethyl)phenyl]-2,3,3a,4,5,6,7,8-octahydro-1H-azulene-1-carboxamide.
| Compound Name | 5-ethyl-6,8a-dimethyl-N-[5-methyl-2-(trifluoromethyl)phenyl]-2,3,3a,4,5,6,7,8-octahydro-1H-azulene-1-carboxamide |
|---|---|
| PubChem CID | 142266534 |
| Molecular Formula | C23H32F3NO |
| Molecular Weight | 395.51 g/mol |
| Exact Mass | 395.24 |
| IUPAC Name | 5-ethyl-6,8a-dimethyl-N-[5-methyl-2-(trifluoromethyl)phenyl]-2,3,3a,4,5,6,7,8-octahydro-1H-azulene-1-carboxamide |
| SMILES | CCC1CC2CCC(C(=O)Nc3cc(C)ccc3C(F)(F)F)C2(C)CCC1C |
| InChI | InChI=1S/C23H32F3NO/c1-5-16-13-17-7-9-19(22(17,4)11-10-15(16)3)21(28)27-20-12-14(2)6-8-18(20)23(24,25)26/h6,8,12,15-17,19H,5,7,9-11,13H2,1-4H3,(H,27,28) |
| InChIKey | BNFCGAMSBASBAP-UHFFFAOYSA-N |
| XLogP | 6.83 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.51 |
| LogP ≤ 5 | 6.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |