C28H31F3N2O3S — CID 142267340
difluoromethane;4-[[4-[2-(5-ethyl-4-phenylthiophen-2-yl)-1,3-oxazol-4-yl]phenyl]methylamino]butanoic acid;fluoromethane (PubChem CID 142267340) has the molecular formula C28H31F3N2O3S and a molecular weight of 532.63 g/mol. Its IUPAC name is difluoromethane;4-[[4-[2-(5-ethyl-4-phenylthiophen-2-yl)-1,3-oxazol-4-yl]phenyl]methylamino]butanoic acid;fluoromethane.
| Compound Name | difluoromethane;4-[[4-[2-(5-ethyl-4-phenylthiophen-2-yl)-1,3-oxazol-4-yl]phenyl]methylamino]butanoic acid;fluoromethane |
|---|---|
| PubChem CID | 142267340 |
| Molecular Formula | C28H31F3N2O3S |
| Molecular Weight | 532.63 g/mol |
| Exact Mass | 532.20 |
| IUPAC Name | difluoromethane;4-[[4-[2-(5-ethyl-4-phenylthiophen-2-yl)-1,3-oxazol-4-yl]phenyl]methylamino]butanoic acid;fluoromethane |
| SMILES | CCc1sc(-c2nc(-c3ccc(CNCCCC(=O)O)cc3)co2)cc1-c1ccccc1.CF.FCF |
| InChI | InChI=1S/C26H26N2O3S.CH2F2.CH3F/c1-2-23-21(19-7-4-3-5-8-19)15-24(32-23)26-28-22(17-31-26)20-12-10-18(11-13-20)16-27-14-6-9-25(29)30;2-1-3;1-2/h3-5,7-8,10-13,15,17,27H,2,6,9,14,16H2,1H3,(H,29,30);1H2;1H3 |
| InChIKey | XFOYBGHPZSZJCQ-UHFFFAOYSA-N |
| XLogP | 7.72 |
| TPSA | 75.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.63 |
| LogP ≤ 5 | 7.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|