C21H27IO — CID 142267650
1-hexoxy-3-[4-[(Z)-prop-1-enyl]phenyl]benzene;hydroiodide (PubChem CID 142267650) has the molecular formula C21H27IO and a molecular weight of 422.35 g/mol. Its IUPAC name is 1-hexoxy-3-[4-[(Z)-prop-1-enyl]phenyl]benzene;hydroiodide.
| Compound Name | 1-hexoxy-3-[4-[(Z)-prop-1-enyl]phenyl]benzene;hydroiodide |
|---|---|
| PubChem CID | 142267650 |
| Molecular Formula | C21H27IO |
| Molecular Weight | 422.35 g/mol |
| Exact Mass | 422.11 |
| IUPAC Name | 1-hexoxy-3-[4-[(Z)-prop-1-enyl]phenyl]benzene;hydroiodide |
| SMILES | C/C=C\c1ccc(-c2cccc(OCCCCCC)c2)cc1.I |
| InChI | InChI=1S/C21H26O.HI/c1-3-5-6-7-16-22-21-11-8-10-20(17-21)19-14-12-18(9-4-2)13-15-19;/h4,8-15,17H,3,5-7,16H2,1-2H3;1H/b9-4-; |
| InChIKey | NIQQXTQJFQNWCI-WONROIIJSA-N |
| XLogP | 6.96 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.35 |
| LogP ≤ 5 | 6.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|