C21H17FN6S — CID 142269328
2-(aminomethyl)-N-(3-fluoro-4-pyridin-4-ylsulfanylphenyl)-6-pyridin-3-ylpyrimidin-4-amine (PubChem CID 142269328) has the molecular formula C21H17FN6S and a molecular weight of 404.47 g/mol. Its IUPAC name is 2-(aminomethyl)-N-(3-fluoro-4-pyridin-4-ylsulfanylphenyl)-6-pyridin-3-ylpyrimidin-4-amine.
| Compound Name | 2-(aminomethyl)-N-(3-fluoro-4-pyridin-4-ylsulfanylphenyl)-6-pyridin-3-ylpyrimidin-4-amine |
|---|---|
| PubChem CID | 142269328 |
| Molecular Formula | C21H17FN6S |
| Molecular Weight | 404.47 g/mol |
| Exact Mass | 404.12 |
| IUPAC Name | 2-(aminomethyl)-N-(3-fluoro-4-pyridin-4-ylsulfanylphenyl)-6-pyridin-3-ylpyrimidin-4-amine |
| SMILES | NCc1nc(Nc2ccc(Sc3ccncc3)c(F)c2)cc(-c2cccnc2)n1 |
| InChI | InChI=1S/C21H17FN6S/c22-17-10-15(3-4-19(17)29-16-5-8-24-9-6-16)26-20-11-18(27-21(12-23)28-20)14-2-1-7-25-13-14/h1-11,13H,12,23H2,(H,26,27,28) |
| InChIKey | PXAGVLHAJSZUAO-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 89.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.47 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |