C16H16N4 — CID 142270254
12-methyl-8-(5-methyl-1H-1,2,4-triazol-3-yl)tricyclo[5.4.1.04,12]dodeca-1(11),2,5,7,9-pentaen-4-amine (PubChem CID 142270254) has the molecular formula C16H16N4 and a molecular weight of 264.33 g/mol. Its IUPAC name is 12-methyl-8-(5-methyl-1H-1,2,4-triazol-3-yl)tricyclo[5.4.1.04,12]dodeca-1(11),2,5,7,9-pentaen-4-amine.
| Compound Name | 12-methyl-8-(5-methyl-1H-1,2,4-triazol-3-yl)tricyclo[5.4.1.04,12]dodeca-1(11),2,5,7,9-pentaen-4-amine |
|---|---|
| PubChem CID | 142270254 |
| Molecular Formula | C16H16N4 |
| Molecular Weight | 264.33 g/mol |
| Exact Mass | 264.14 |
| IUPAC Name | 12-methyl-8-(5-methyl-1H-1,2,4-triazol-3-yl)tricyclo[5.4.1.04,12]dodeca-1(11),2,5,7,9-pentaen-4-amine |
| SMILES | Cc1nc(C2=C3C=CC4(N)C=CC(=CC=C2)C34C)n[nH]1 |
| InChI | InChI=1S/C16H16N4/c1-10-18-14(20-19-10)12-5-3-4-11-6-8-16(17)9-7-13(12)15(11,16)2/h3-9H,17H2,1-2H3,(H,18,19,20) |
| InChIKey | ZPYQZAHILZVMEF-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 67.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.33 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |