C23H25N6+ — CID 163963321
3-cyclohepta-1,5-dien-1-yl-5-[5-(3-cyclohexa-1,5-dien-1-yl-1H-1,2,4-triazol-1-ium-5-yl)cyclohexa-2,4-dien-1-yl]-1H-1,2,4-triazole (PubChem CID 163963321) has the molecular formula C23H25N6+ and a molecular weight of 385.50 g/mol. Its IUPAC name is 3-cyclohepta-1,5-dien-1-yl-5-[5-(3-cyclohexa-1,5-dien-1-yl-1H-1,2,4-triazol-1-ium-5-yl)cyclohexa-2,4-dien-1-yl]-1H-1,2,4-triazole.
| Compound Name | 3-cyclohepta-1,5-dien-1-yl-5-[5-(3-cyclohexa-1,5-dien-1-yl-1H-1,2,4-triazol-1-ium-5-yl)cyclohexa-2,4-dien-1-yl]-1H-1,2,4-triazole |
|---|---|
| PubChem CID | 163963321 |
| Molecular Formula | C23H25N6+ |
| Molecular Weight | 385.50 g/mol |
| Exact Mass | 385.21 |
| IUPAC Name | 3-cyclohepta-1,5-dien-1-yl-5-[5-(3-cyclohexa-1,5-dien-1-yl-1H-1,2,4-triazol-1-ium-5-yl)cyclohexa-2,4-dien-1-yl]-1H-1,2,4-triazole |
| SMILES | C1=CC(c2nc(C3=CCCC=CC3)n[nH]2)CC(C2=NC(C3=CCCC=C3)=N[NH2+]2)=C1 |
| InChI | InChI=1S/C23H24N6/c1-2-5-10-16(9-4-1)20-24-22(28-26-20)18-13-8-14-19(15-18)23-25-21(27-29-23)17-11-6-3-7-12-17/h1,4,6,8,10-14,18H,2-3,5,7,9,15H2,(H,24,26,28)(H,25,27,29)/p+1 |
| InChIKey | SJKVLPAHNCKZHT-UHFFFAOYSA-O |
| XLogP | 3.46 |
| TPSA | 82.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.50 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|