C26H37ClN4 — CID 142270419
1-N-[(4-aminophenyl)methyl]-1-N-[2-(azepan-1-yl)ethyl]-2-N-(2-chloro-6-ethylphenyl)prop-2-ene-1,2-diamine (PubChem CID 142270419) has the molecular formula C26H37ClN4 and a molecular weight of 441.06 g/mol. Its IUPAC name is 1-N-[(4-aminophenyl)methyl]-1-N-[2-(azepan-1-yl)ethyl]-2-N-(2-chloro-6-ethylphenyl)prop-2-ene-1,2-diamine.
| Compound Name | 1-N-[(4-aminophenyl)methyl]-1-N-[2-(azepan-1-yl)ethyl]-2-N-(2-chloro-6-ethylphenyl)prop-2-ene-1,2-diamine |
|---|---|
| PubChem CID | 142270419 |
| Molecular Formula | C26H37ClN4 |
| Molecular Weight | 441.06 g/mol |
| Exact Mass | 440.27 |
| IUPAC Name | 1-N-[(4-aminophenyl)methyl]-1-N-[2-(azepan-1-yl)ethyl]-2-N-(2-chloro-6-ethylphenyl)prop-2-ene-1,2-diamine |
| SMILES | C=C(CN(CCN1CCCCCC1)Cc1ccc(N)cc1)Nc1c(Cl)cccc1CC |
| InChI | InChI=1S/C26H37ClN4/c1-3-23-9-8-10-25(27)26(23)29-21(2)19-31(20-22-11-13-24(28)14-12-22)18-17-30-15-6-4-5-7-16-30/h8-14,29H,2-7,15-20,28H2,1H3 |
| InChIKey | HQAVOBDEXQFLPE-UHFFFAOYSA-N |
| XLogP | 5.79 |
| TPSA | 44.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.06 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|