C26H34N4O3 — CID 142270453
methyl 3-[2-[(4-cyanophenyl)methyl-[3-(diethylamino)propyl]amino]propanoylamino]benzoate (PubChem CID 142270453) has the molecular formula C26H34N4O3 and a molecular weight of 450.58 g/mol. Its IUPAC name is methyl 3-[2-[(4-cyanophenyl)methyl-[3-(diethylamino)propyl]amino]propanoylamino]benzoate.
| Compound Name | methyl 3-[2-[(4-cyanophenyl)methyl-[3-(diethylamino)propyl]amino]propanoylamino]benzoate |
|---|---|
| PubChem CID | 142270453 |
| Molecular Formula | C26H34N4O3 |
| Molecular Weight | 450.58 g/mol |
| Exact Mass | 450.26 |
| IUPAC Name | methyl 3-[2-[(4-cyanophenyl)methyl-[3-(diethylamino)propyl]amino]propanoylamino]benzoate |
| SMILES | CCN(CC)CCCN(Cc1ccc(C#N)cc1)C(C)C(=O)Nc1cccc(C(=O)OC)c1 |
| InChI | InChI=1S/C26H34N4O3/c1-5-29(6-2)15-8-16-30(19-22-13-11-21(18-27)12-14-22)20(3)25(31)28-24-10-7-9-23(17-24)26(32)33-4/h7,9-14,17,20H,5-6,8,15-16,19H2,1-4H3,(H,28,31) |
| InChIKey | FPLCZGVWSNJGSC-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 85.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.58 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |