C25H22BrN3O3 — CID 112832674
3-[(3-bromobenzoyl)amino]-N-[(4-cyanophenyl)methyl]-N-(2-methoxyethyl)benzamide (PubChem CID 112832674) has the molecular formula C25H22BrN3O3 and a molecular weight of 492.37 g/mol. Its IUPAC name is 3-[(3-bromobenzoyl)amino]-N-[(4-cyanophenyl)methyl]-N-(2-methoxyethyl)benzamide.
| Compound Name | 3-[(3-bromobenzoyl)amino]-N-[(4-cyanophenyl)methyl]-N-(2-methoxyethyl)benzamide |
|---|---|
| PubChem CID | 112832674 |
| Molecular Formula | C25H22BrN3O3 |
| Molecular Weight | 492.37 g/mol |
| Exact Mass | 491.08 |
| IUPAC Name | 3-[(3-bromobenzoyl)amino]-N-[(4-cyanophenyl)methyl]-N-(2-methoxyethyl)benzamide |
| SMILES | COCCN(Cc1ccc(C#N)cc1)C(=O)c1cccc(NC(=O)c2cccc(Br)c2)c1 |
| InChI | InChI=1S/C25H22BrN3O3/c1-32-13-12-29(17-19-10-8-18(16-27)9-11-19)25(31)21-5-3-7-23(15-21)28-24(30)20-4-2-6-22(26)14-20/h2-11,14-15H,12-13,17H2,1H3,(H,28,30) |
| InChIKey | BFLKLRZXPJKXGK-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 82.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.37 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |