C18H30O — CID 142271030
(2E,4Z)-8-(3-ethylcyclohexyl)-3-methyl-6-methylideneocta-2,4-dien-2-ol (PubChem CID 142271030) has the molecular formula C18H30O and a molecular weight of 262.44 g/mol. Its IUPAC name is (2E,4Z)-8-(3-ethylcyclohexyl)-3-methyl-6-methylideneocta-2,4-dien-2-ol.
| Compound Name | (2E,4Z)-8-(3-ethylcyclohexyl)-3-methyl-6-methylideneocta-2,4-dien-2-ol |
|---|---|
| PubChem CID | 142271030 |
| Molecular Formula | C18H30O |
| Molecular Weight | 262.44 g/mol |
| Exact Mass | 262.23 |
| IUPAC Name | (2E,4Z)-8-(3-ethylcyclohexyl)-3-methyl-6-methylideneocta-2,4-dien-2-ol |
| SMILES | C=C(/C=C\C(C)=C(/C)O)CCC1CCCC(CC)C1 |
| InChI | InChI=1S/C18H30O/c1-5-17-7-6-8-18(13-17)12-10-14(2)9-11-15(3)16(4)19/h9,11,17-19H,2,5-8,10,12-13H2,1,3-4H3/b11-9-,16-15+ |
| InChIKey | UKKHYKGSMUVDRG-ABDGSJBQSA-N |
| XLogP | 5.95 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.44 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|