C15H28O — CID 64503603
1-(3-ethylcyclohexyl)-4,4-dimethylpentan-3-one (PubChem CID 64503603) has the molecular formula C15H28O and a molecular weight of 224.39 g/mol. Its IUPAC name is 1-(3-ethylcyclohexyl)-4,4-dimethylpentan-3-one.
| Compound Name | 1-(3-ethylcyclohexyl)-4,4-dimethylpentan-3-one |
|---|---|
| PubChem CID | 64503603 |
| Molecular Formula | C15H28O |
| Molecular Weight | 224.39 g/mol |
| Exact Mass | 224.21 |
| IUPAC Name | 1-(3-ethylcyclohexyl)-4,4-dimethylpentan-3-one |
| SMILES | CCC1CCCC(CCC(=O)C(C)(C)C)C1 |
| InChI | InChI=1S/C15H28O/c1-5-12-7-6-8-13(11-12)9-10-14(16)15(2,3)4/h12-13H,5-11H2,1-4H3 |
| InChIKey | YXIGGEMFSUSFJQ-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.39 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |