C15H29Cl — CID 64507103
1-(3-chloro-4,4-dimethylpentyl)-3-ethylcyclohexane (PubChem CID 64507103) has the molecular formula C15H29Cl and a molecular weight of 244.85 g/mol. Its IUPAC name is 1-(3-chloro-4,4-dimethylpentyl)-3-ethylcyclohexane.
| Compound Name | 1-(3-chloro-4,4-dimethylpentyl)-3-ethylcyclohexane |
|---|---|
| PubChem CID | 64507103 |
| Molecular Formula | C15H29Cl |
| Molecular Weight | 244.85 g/mol |
| Exact Mass | 244.20 |
| IUPAC Name | 1-(3-chloro-4,4-dimethylpentyl)-3-ethylcyclohexane |
| SMILES | CCC1CCCC(CCC(Cl)C(C)(C)C)C1 |
| InChI | InChI=1S/C15H29Cl/c1-5-12-7-6-8-13(11-12)9-10-14(16)15(2,3)4/h12-14H,5-11H2,1-4H3 |
| InChIKey | DAIHKBABSSHKCS-UHFFFAOYSA-N |
| XLogP | 5.64 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.85 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|