C24H52 — CID 164992405
1,3-diethylcyclohexane;hexane;3-methylheptane (PubChem CID 164992405) has the molecular formula C24H52 and a molecular weight of 340.68 g/mol. Its IUPAC name is 1,3-diethylcyclohexane;hexane;3-methylheptane.
| Compound Name | 1,3-diethylcyclohexane;hexane;3-methylheptane |
|---|---|
| PubChem CID | 164992405 |
| Molecular Formula | C24H52 |
| Molecular Weight | 340.68 g/mol |
| Exact Mass | 340.41 |
| IUPAC Name | 1,3-diethylcyclohexane;hexane;3-methylheptane |
| SMILES | CCC1CCCC(CC)C1.CCCCC(C)CC.CCCCCC |
| InChI | InChI=1S/C10H20.C8H18.C6H14/c1-3-9-6-5-7-10(4-2)8-9;1-4-6-7-8(3)5-2;1-3-5-6-4-2/h9-10H,3-8H2,1-2H3;8H,4-7H2,1-3H3;3-6H2,1-2H3 |
| InChIKey | HAVWHQKZBYBYGT-UHFFFAOYSA-N |
| XLogP | 9.42 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.68 |
| LogP ≤ 5 | 9.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|