C23H50 — CID 144926109
1-(2,5-dimethylhexyl)-3-ethylcyclohexane;ethane;pentane (PubChem CID 144926109) has the molecular formula C23H50 and a molecular weight of 326.65 g/mol. Its IUPAC name is 1-(2,5-dimethylhexyl)-3-ethylcyclohexane;ethane;pentane.
| Compound Name | 1-(2,5-dimethylhexyl)-3-ethylcyclohexane;ethane;pentane |
|---|---|
| PubChem CID | 144926109 |
| Molecular Formula | C23H50 |
| Molecular Weight | 326.65 g/mol |
| Exact Mass | 326.39 |
| IUPAC Name | 1-(2,5-dimethylhexyl)-3-ethylcyclohexane;ethane;pentane |
| SMILES | CC.CCC1CCCC(CC(C)CCC(C)C)C1.CCCCC |
| InChI | InChI=1S/C16H32.C5H12.C2H6/c1-5-15-7-6-8-16(12-15)11-14(4)10-9-13(2)3;1-3-5-4-2;1-2/h13-16H,5-12H2,1-4H3;3-5H2,1-2H3;1-2H3 |
| InChIKey | RKOOXIZFLSNCMM-UHFFFAOYSA-N |
| XLogP | 8.89 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.65 |
| LogP ≤ 5 | 8.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |