C21H36CuO4 — CID 71586776
View drug profile → copper naphthenatecopper;3-(4-ethylcyclohexyl)propanoate;3-(3-ethylcyclopentyl)propanoate (PubChem CID 71586776) has the molecular formula C21H36CuO4 and a molecular weight of 416.06 g/mol. Its IUPAC name is copper;3-(4-ethylcyclohexyl)propanoate;3-(3-ethylcyclopentyl)propanoate.
| Compound Name | copper;3-(4-ethylcyclohexyl)propanoate;3-(3-ethylcyclopentyl)propanoate |
|---|---|
| PubChem CID | 71586776 |
| Molecular Formula | C21H36CuO4 |
| Molecular Weight | 416.06 g/mol |
| Exact Mass | 415.19 |
| IUPAC Name | copper;3-(4-ethylcyclohexyl)propanoate;3-(3-ethylcyclopentyl)propanoate |
| SMILES | CCC1CCC(CCC(=O)[O-])C1.CCC1CCC(CCC(=O)[O-])CC1.[Cu+2] |
| InChI | InChI=1S/C11H20O2.C10H18O2.Cu/c1-2-9-3-5-10(6-4-9)7-8-11(12)13;1-2-8-3-4-9(7-8)5-6-10(11)12;/h9-10H,2-8H2,1H3,(H,12,13);8-9H,2-7H2,1H3,(H,11,12);/q;;+2/p-2 |
| InChIKey | SEVNKWFHTNVOLD-UHFFFAOYSA-L |
| XLogP | 3.07 |
| TPSA | 80.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.06 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |