C7H11NO3 — CID 142271078
N-(2-hydroxyethyl)-2,3-dihydrofuran-2-carboxamide (PubChem CID 142271078) has the molecular formula C7H11NO3 and a molecular weight of 157.17 g/mol. Its IUPAC name is N-(2-hydroxyethyl)-2,3-dihydrofuran-2-carboxamide.
| Compound Name | N-(2-hydroxyethyl)-2,3-dihydrofuran-2-carboxamide |
|---|---|
| PubChem CID | 142271078 |
| Molecular Formula | C7H11NO3 |
| Molecular Weight | 157.17 g/mol |
| Exact Mass | 157.07 |
| IUPAC Name | N-(2-hydroxyethyl)-2,3-dihydrofuran-2-carboxamide |
| SMILES | O=C(NCCO)C1CC=CO1 |
| InChI | InChI=1S/C7H11NO3/c9-4-3-8-7(10)6-2-1-5-11-6/h1,5-6,9H,2-4H2,(H,8,10) |
| InChIKey | VJVBSMKDVGQYLL-UHFFFAOYSA-N |
| XLogP | -0.60 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 157.17 |
| LogP ≤ 5 | -0.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |