C11H16N2 — CID 142271471
2-(2-methylpropylideneamino)bicyclo[4.1.0]hepta-2,4-dien-3-amine (PubChem CID 142271471) has the molecular formula C11H16N2 and a molecular weight of 176.26 g/mol. Its IUPAC name is 2-(2-methylpropylideneamino)bicyclo[4.1.0]hepta-2,4-dien-3-amine.
| Compound Name | 2-(2-methylpropylideneamino)bicyclo[4.1.0]hepta-2,4-dien-3-amine |
|---|---|
| PubChem CID | 142271471 |
| Molecular Formula | C11H16N2 |
| Molecular Weight | 176.26 g/mol |
| Exact Mass | 176.13 |
| IUPAC Name | 2-(2-methylpropylideneamino)bicyclo[4.1.0]hepta-2,4-dien-3-amine |
| SMILES | CC(C)/C=N/C1=C(N)C=CC2CC12 |
| InChI | InChI=1S/C11H16N2/c1-7(2)6-13-11-9-5-8(9)3-4-10(11)12/h3-4,6-9H,5,12H2,1-2H3/b13-6+ |
| InChIKey | PSRRQLAGUIRMHD-AWNIVKPZSA-N |
| XLogP | 2.09 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.26 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|