C13H20N2 — CID 163740599
3-[(3Z,5Z)-octa-3,5-dien-2-yl]-3,4-dihydropyridin-5-amine (PubChem CID 163740599) has the molecular formula C13H20N2 and a molecular weight of 204.32 g/mol. Its IUPAC name is 3-[(3Z,5Z)-octa-3,5-dien-2-yl]-3,4-dihydropyridin-5-amine.
| Compound Name | 3-[(3Z,5Z)-octa-3,5-dien-2-yl]-3,4-dihydropyridin-5-amine |
|---|---|
| PubChem CID | 163740599 |
| Molecular Formula | C13H20N2 |
| Molecular Weight | 204.32 g/mol |
| Exact Mass | 204.16 |
| IUPAC Name | 3-[(3Z,5Z)-octa-3,5-dien-2-yl]-3,4-dihydropyridin-5-amine |
| SMILES | CC/C=C\C=C/C(C)C1C=NC=C(N)C1 |
| InChI | InChI=1S/C13H20N2/c1-3-4-5-6-7-11(2)12-8-13(14)10-15-9-12/h4-7,9-12H,3,8,14H2,1-2H3/b5-4-,7-6- |
| InChIKey | LHJWNBPHBZWPTD-RZSVFLSASA-N |
| XLogP | 3.04 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.32 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|