C12H22N2 — CID 126584283
(3E,6R)-5-ethyl-8-imino-5,6-dimethylocta-1,3-dien-4-amine (PubChem CID 126584283) has the molecular formula C12H22N2 and a molecular weight of 194.32 g/mol. Its IUPAC name is (3E,6R)-5-ethyl-8-imino-5,6-dimethylocta-1,3-dien-4-amine.
| Compound Name | (3E,6R)-5-ethyl-8-imino-5,6-dimethylocta-1,3-dien-4-amine |
|---|---|
| PubChem CID | 126584283 |
| Molecular Formula | C12H22N2 |
| Molecular Weight | 194.32 g/mol |
| Exact Mass | 194.18 |
| IUPAC Name | (3E,6R)-5-ethyl-8-imino-5,6-dimethylocta-1,3-dien-4-amine |
| SMILES | [H]/N=C/C[C@@H](C)C(C)(CC)/C(N)=C\C=C |
| InChI | InChI=1S/C12H22N2/c1-5-7-11(14)12(4,6-2)10(3)8-9-13/h5,7,9-10,13H,1,6,8,14H2,2-4H3/b11-7+,13-9+/t10-,12?/m1/s1 |
| InChIKey | CBMRYZDTXWHQKW-OHCDTNHZSA-N |
| XLogP | 3.11 |
| TPSA | 49.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.32 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|