About N-[(3Z)-5-ethyl-7,7-dimethylocta-1,3-dien-4-yl]ethanimine
N-[(3Z)-5-ethyl-7,7-dimethylocta-1,3-dien-4-yl]ethanimine (PubChem CID 144765342) has the molecular formula C14H25N
and a molecular weight of 207.36 g/mol. Its IUPAC name is N-[(3Z)-5-ethyl-7,7-dimethylocta-1,3-dien-4-yl]ethanimine.
Molecular Properties
| Compound Name | N-[(3Z)-5-ethyl-7,7-dimethylocta-1,3-dien-4-yl]ethanimine |
| PubChem CID | 144765342 |
| Molecular Formula | C14H25N |
| Molecular Weight | 207.36 g/mol |
| Exact Mass | 207.20 |
| IUPAC Name | N-[(3Z)-5-ethyl-7,7-dimethylocta-1,3-dien-4-yl]ethanimine |
| SMILES | C=C/C=C(\N=C\C)C(CC)CC(C)(C)C |
| InChI | InChI=1S/C14H25N/c1-7-10-13(15-9-3)12(8-2)11-14(4,5)6/h7,9-10,12H,1,8,11H2,2-6H3/b13-10-,15-9+ |
| InChIKey | YFBIYMNRUFYGAW-PDGVQJANSA-N |
| XLogP | 4.61 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 207.36 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze N-[(3Z)-5-ethyl-7,7-dimethylocta-1,3-dien-4-yl]ethanimine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(3Z)-5-ethyl-7,7-dimethylocta-1,3-dien-4-yl]ethanimine?
The IUPAC name of N-[(3Z)-5-ethyl-7,7-dimethylocta-1,3-dien-4-yl]ethanimine (CID 144765342) is N-[(3Z)-5-ethyl-7,7-dimethylocta-1,3-dien-4-yl]ethanimine.
What is the SMILES notation for N-[(3Z)-5-ethyl-7,7-dimethylocta-1,3-dien-4-yl]ethanimine?
The canonical SMILES for N-[(3Z)-5-ethyl-7,7-dimethylocta-1,3-dien-4-yl]ethanimine is C=C/C=C(\N=C\C)C(CC)CC(C)(C)C.
What is the InChIKey of N-[(3Z)-5-ethyl-7,7-dimethylocta-1,3-dien-4-yl]ethanimine?
The InChIKey is YFBIYMNRUFYGAW-PDGVQJANSA-N. The full InChI is InChI=1S/C14H25N/c1-7-10-13(15-9-3)12(8-2)11-14(4,5)6/h7,9-10,12H,1,8,11H2,2-6H3/b13-10-,15-9+.
What are the key properties of N-[(3Z)-5-ethyl-7,7-dimethylocta-1,3-dien-4-yl]ethanimine?
N-[(3Z)-5-ethyl-7,7-dimethylocta-1,3-dien-4-yl]ethanimine has a molecular weight of 207.36 g/mol, XLogP of 4.61, 5 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(3Z)-5-ethyl-7,7-dimethylocta-1,3-dien-4-yl]ethanimine is sourced from PubChem (CID 144765342), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).