C16H29N — CID 144768985
N-[(3Z)-5-tert-butyl-7,7-dimethylocta-1,3-dien-4-yl]ethanimine (PubChem CID 144768985) has the molecular formula C16H29N and a molecular weight of 235.41 g/mol. Its IUPAC name is N-[(3Z)-5-tert-butyl-7,7-dimethylocta-1,3-dien-4-yl]ethanimine.
| Compound Name | N-[(3Z)-5-tert-butyl-7,7-dimethylocta-1,3-dien-4-yl]ethanimine |
|---|---|
| PubChem CID | 144768985 |
| Molecular Formula | C16H29N |
| Molecular Weight | 235.41 g/mol |
| Exact Mass | 235.23 |
| IUPAC Name | N-[(3Z)-5-tert-butyl-7,7-dimethylocta-1,3-dien-4-yl]ethanimine |
| SMILES | C=C/C=C(\N=C\C)C(CC(C)(C)C)C(C)(C)C |
| InChI | InChI=1S/C16H29N/c1-9-11-14(17-10-2)13(16(6,7)8)12-15(3,4)5/h9-11,13H,1,12H2,2-8H3/b14-11-,17-10+ |
| InChIKey | LMLMQYSKHKRVMG-HOVRWEJTSA-N |
| XLogP | 5.25 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.41 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|