C15H21N — CID 123904964
3-methyl-N-(2,6,6-trimethyl-3-bicyclo[3.1.0]hex-2-enyl)penta-2,4-dien-1-imine (PubChem CID 123904964) has the molecular formula C15H21N and a molecular weight of 215.34 g/mol. Its IUPAC name is 3-methyl-N-(2,6,6-trimethyl-3-bicyclo[3.1.0]hex-2-enyl)penta-2,4-dien-1-imine.
| Compound Name | 3-methyl-N-(2,6,6-trimethyl-3-bicyclo[3.1.0]hex-2-enyl)penta-2,4-dien-1-imine |
|---|---|
| PubChem CID | 123904964 |
| Molecular Formula | C15H21N |
| Molecular Weight | 215.34 g/mol |
| Exact Mass | 215.17 |
| IUPAC Name | 3-methyl-N-(2,6,6-trimethyl-3-bicyclo[3.1.0]hex-2-enyl)penta-2,4-dien-1-imine |
| SMILES | C=CC(C)=C/C=N/C1=C(C)C2C(C1)C2(C)C |
| InChI | InChI=1S/C15H21N/c1-6-10(2)7-8-16-13-9-12-14(11(13)3)15(12,4)5/h6-8,12,14H,1,9H2,2-5H3/b10-7?,16-8+ |
| InChIKey | CZJBDARJQVYCHZ-OOSLVLPHSA-N |
| XLogP | 4.14 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.34 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|