C23H27NOS — CID 142271627
(3Z,5Z)-N-[[1-(1-benzothiophen-3-yl)cyclohexyl]methyl]-2-methylidenehepta-3,5-dienamide (PubChem CID 142271627) has the molecular formula C23H27NOS and a molecular weight of 365.54 g/mol. Its IUPAC name is (3Z,5Z)-N-[[1-(1-benzothiophen-3-yl)cyclohexyl]methyl]-2-methylidenehepta-3,5-dienamide.
| Compound Name | (3Z,5Z)-N-[[1-(1-benzothiophen-3-yl)cyclohexyl]methyl]-2-methylidenehepta-3,5-dienamide |
|---|---|
| PubChem CID | 142271627 |
| Molecular Formula | C23H27NOS |
| Molecular Weight | 365.54 g/mol |
| Exact Mass | 365.18 |
| IUPAC Name | (3Z,5Z)-N-[[1-(1-benzothiophen-3-yl)cyclohexyl]methyl]-2-methylidenehepta-3,5-dienamide |
| SMILES | C=C(/C=C\C=C/C)C(=O)NCC1(c2csc3ccccc23)CCCCC1 |
| InChI | InChI=1S/C23H27NOS/c1-3-4-6-11-18(2)22(25)24-17-23(14-9-5-10-15-23)20-16-26-21-13-8-7-12-19(20)21/h3-4,6-8,11-13,16H,2,5,9-10,14-15,17H2,1H3,(H,24,25)/b4-3-,11-6- |
| InChIKey | PCDDUPVGFCOGLD-ZRTVSTLASA-N |
| XLogP | 5.91 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.54 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|