C13H20O2S — CID 14227218
1-methoxy-3,3-dimethyl-1-phenylsulfanylbutan-2-ol (PubChem CID 14227218) has the molecular formula C13H20O2S and a molecular weight of 240.37 g/mol. Its IUPAC name is 1-methoxy-3,3-dimethyl-1-phenylsulfanylbutan-2-ol.
| Compound Name | 1-methoxy-3,3-dimethyl-1-phenylsulfanylbutan-2-ol |
|---|---|
| PubChem CID | 14227218 |
| Molecular Formula | C13H20O2S |
| Molecular Weight | 240.37 g/mol |
| Exact Mass | 240.12 |
| IUPAC Name | 1-methoxy-3,3-dimethyl-1-phenylsulfanylbutan-2-ol |
| SMILES | COC(Sc1ccccc1)C(O)C(C)(C)C |
| InChI | InChI=1S/C13H20O2S/c1-13(2,3)11(14)12(15-4)16-10-8-6-5-7-9-10/h5-9,11-12,14H,1-4H3 |
| InChIKey | KXEGMKPULGZGJG-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.37 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|