C23H28F2N2O2 — CID 142272576
(1E)-1-[(2,6-difluorophenyl)methylidene]-3-(4-nonoxyphenyl)urea (PubChem CID 142272576) has the molecular formula C23H28F2N2O2 and a molecular weight of 402.49 g/mol. Its IUPAC name is (1E)-1-[(2,6-difluorophenyl)methylidene]-3-(4-nonoxyphenyl)urea.
| Compound Name | (1E)-1-[(2,6-difluorophenyl)methylidene]-3-(4-nonoxyphenyl)urea |
|---|---|
| PubChem CID | 142272576 |
| Molecular Formula | C23H28F2N2O2 |
| Molecular Weight | 402.49 g/mol |
| Exact Mass | 402.21 |
| IUPAC Name | (1E)-1-[(2,6-difluorophenyl)methylidene]-3-(4-nonoxyphenyl)urea |
| SMILES | CCCCCCCCCOc1ccc(NC(=O)/N=C/c2c(F)cccc2F)cc1 |
| InChI | InChI=1S/C23H28F2N2O2/c1-2-3-4-5-6-7-8-16-29-19-14-12-18(13-15-19)27-23(28)26-17-20-21(24)10-9-11-22(20)25/h9-15,17H,2-8,16H2,1H3,(H,27,28)/b26-17+ |
| InChIKey | NUFLMMIEXMKRFQ-YZSQISJMSA-N |
| XLogP | 6.75 |
| TPSA | 50.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.49 |
| LogP ≤ 5 | 6.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|