About ethane;methanethiol;1-methoxy-3-[(2-methylpropan-2-yl)oxymethyl]benzene
ethane;methanethiol;1-methoxy-3-[(2-methylpropan-2-yl)oxymethyl]benzene (PubChem CID 142276005) has the molecular formula C15H28O2S
and a molecular weight of 272.45 g/mol. Its IUPAC name is ethane;methanethiol;1-methoxy-3-[(2-methylpropan-2-yl)oxymethyl]benzene.
Molecular Properties
| Compound Name | ethane;methanethiol;1-methoxy-3-[(2-methylpropan-2-yl)oxymethyl]benzene |
| PubChem CID | 142276005 |
| Molecular Formula | C15H28O2S |
| Molecular Weight | 272.45 g/mol |
| Exact Mass | 272.18 |
| IUPAC Name | ethane;methanethiol;1-methoxy-3-[(2-methylpropan-2-yl)oxymethyl]benzene |
| SMILES | CC.COc1cccc(COC(C)(C)C)c1.CS |
| InChI | InChI=1S/C12H18O2.C2H6.CH4S/c1-12(2,3)14-9-10-6-5-7-11(8-10)13-4;2*1-2/h5-8H,9H2,1-4H3;1-2H3;2H,1H3 |
| InChIKey | UTXVLHJOTRQAMX-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 18.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 272.45 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze ethane;methanethiol;1-methoxy-3-[(2-methylpropan-2-yl)oxymethyl]benzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;methanethiol;1-methoxy-3-[(2-methylpropan-2-yl)oxymethyl]benzene?
The IUPAC name of ethane;methanethiol;1-methoxy-3-[(2-methylpropan-2-yl)oxymethyl]benzene (CID 142276005) is ethane;methanethiol;1-methoxy-3-[(2-methylpropan-2-yl)oxymethyl]benzene.
What is the SMILES notation for ethane;methanethiol;1-methoxy-3-[(2-methylpropan-2-yl)oxymethyl]benzene?
The canonical SMILES for ethane;methanethiol;1-methoxy-3-[(2-methylpropan-2-yl)oxymethyl]benzene is CC.COc1cccc(COC(C)(C)C)c1.CS.
What is the InChIKey of ethane;methanethiol;1-methoxy-3-[(2-methylpropan-2-yl)oxymethyl]benzene?
The InChIKey is UTXVLHJOTRQAMX-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H18O2.C2H6.CH4S/c1-12(2,3)14-9-10-6-5-7-11(8-10)13-4;2*1-2/h5-8H,9H2,1-4H3;1-2H3;2H,1H3.
What are the key properties of ethane;methanethiol;1-methoxy-3-[(2-methylpropan-2-yl)oxymethyl]benzene?
ethane;methanethiol;1-methoxy-3-[(2-methylpropan-2-yl)oxymethyl]benzene has a molecular weight of 272.45 g/mol, XLogP of 4.58, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;methanethiol;1-methoxy-3-[(2-methylpropan-2-yl)oxymethyl]benzene is sourced from PubChem (CID 142276005), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).