C30H36ClN5O3 — CID 142278088
tert-butyl piperazine-1-carboxylate;13-chloro-10-[2-(2,3-dimethylimidazol-4-yl)oxiran-2-yl]-4-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,9,12,14-heptaene (PubChem CID 142278088) has the molecular formula C30H36ClN5O3 and a molecular weight of 550.10 g/mol. Its IUPAC name is tert-butyl piperazine-1-carboxylate;13-chloro-10-[2-(2,3-dimethylimidazol-4-yl)oxiran-2-yl]-4-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,9,12,14-heptaene.
| Compound Name | tert-butyl piperazine-1-carboxylate;13-chloro-10-[2-(2,3-dimethylimidazol-4-yl)oxiran-2-yl]-4-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,9,12,14-heptaene |
|---|---|
| PubChem CID | 142278088 |
| Molecular Formula | C30H36ClN5O3 |
| Molecular Weight | 550.10 g/mol |
| Exact Mass | 549.25 |
| IUPAC Name | tert-butyl piperazine-1-carboxylate;13-chloro-10-[2-(2,3-dimethylimidazol-4-yl)oxiran-2-yl]-4-azatricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,9,12,14-heptaene |
| SMILES | CC(C)(C)OC(=O)N1CCNCC1.Cc1ncc(C2(C3=Cc4cccnc4Cc4ccc(Cl)cc43)CO2)n1C |
| InChI | InChI=1S/C21H18ClN3O.C9H18N2O2/c1-13-24-11-20(25(13)2)21(12-26-21)18-8-15-4-3-7-23-19(15)9-14-5-6-16(22)10-17(14)18;1-9(2,3)13-8(12)11-6-4-10-5-7-11/h3-8,10-11H,9,12H2,1-2H3;10H,4-7H2,1-3H3 |
| InChIKey | PPLCCIGSMDWTKP-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 84.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.10 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|