C30H38ClN5O3 — CID 142278130
tert-butyl piperazine-1-carboxylate;13-chloro-10-[2-(3,5-dimethylimidazol-4-yl)oxiran-2-yl]-4-azatricyclo[9.4.0.03,8]pentadeca-1(11),5,7,9,12,14-hexaene (PubChem CID 142278130) has the molecular formula C30H38ClN5O3 and a molecular weight of 552.12 g/mol. Its IUPAC name is tert-butyl piperazine-1-carboxylate;13-chloro-10-[2-(3,5-dimethylimidazol-4-yl)oxiran-2-yl]-4-azatricyclo[9.4.0.03,8]pentadeca-1(11),5,7,9,12,14-hexaene.
| Compound Name | tert-butyl piperazine-1-carboxylate;13-chloro-10-[2-(3,5-dimethylimidazol-4-yl)oxiran-2-yl]-4-azatricyclo[9.4.0.03,8]pentadeca-1(11),5,7,9,12,14-hexaene |
|---|---|
| PubChem CID | 142278130 |
| Molecular Formula | C30H38ClN5O3 |
| Molecular Weight | 552.12 g/mol |
| Exact Mass | 551.27 |
| IUPAC Name | tert-butyl piperazine-1-carboxylate;13-chloro-10-[2-(3,5-dimethylimidazol-4-yl)oxiran-2-yl]-4-azatricyclo[9.4.0.03,8]pentadeca-1(11),5,7,9,12,14-hexaene |
| SMILES | CC(C)(C)OC(=O)N1CCNCC1.Cc1ncn(C)c1C1(C2=CC3=CC=CNC3Cc3ccc(Cl)cc32)CO1 |
| InChI | InChI=1S/C21H20ClN3O.C9H18N2O2/c1-13-20(25(2)12-24-13)21(11-26-21)18-8-15-4-3-7-23-19(15)9-14-5-6-16(22)10-17(14)18;1-9(2,3)13-8(12)11-6-4-10-5-7-11/h3-8,10,12,19,23H,9,11H2,1-2H3;10H,4-7H2,1-3H3 |
| InChIKey | HXIBJAXFOYDYHE-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 83.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.12 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|