C29H38ClN7O3 — CID 142278042
tert-butyl piperazine-1-carboxylate;[(13-chloro-4-azatricyclo[9.4.0.03,8]pentadeca-1(11),5,7,9,12,14-hexaen-10-yl)-(3-methylimidazol-4-yl)methyl]urea (PubChem CID 142278042) has the molecular formula C29H38ClN7O3 and a molecular weight of 568.12 g/mol. Its IUPAC name is tert-butyl piperazine-1-carboxylate;[(13-chloro-4-azatricyclo[9.4.0.03,8]pentadeca-1(11),5,7,9,12,14-hexaen-10-yl)-(3-methylimidazol-4-yl)methyl]urea.
| Compound Name | tert-butyl piperazine-1-carboxylate;[(13-chloro-4-azatricyclo[9.4.0.03,8]pentadeca-1(11),5,7,9,12,14-hexaen-10-yl)-(3-methylimidazol-4-yl)methyl]urea |
|---|---|
| PubChem CID | 142278042 |
| Molecular Formula | C29H38ClN7O3 |
| Molecular Weight | 568.12 g/mol |
| Exact Mass | 567.27 |
| IUPAC Name | tert-butyl piperazine-1-carboxylate;[(13-chloro-4-azatricyclo[9.4.0.03,8]pentadeca-1(11),5,7,9,12,14-hexaen-10-yl)-(3-methylimidazol-4-yl)methyl]urea |
| SMILES | CC(C)(C)OC(=O)N1CCNCC1.Cn1cncc1C(NC(N)=O)C1=CC2=CC=CNC2Cc2ccc(Cl)cc21 |
| InChI | InChI=1S/C20H20ClN5O.C9H18N2O2/c1-26-11-23-10-18(26)19(25-20(22)27)16-7-13-3-2-6-24-17(13)8-12-4-5-14(21)9-15(12)16;1-9(2,3)13-8(12)11-6-4-10-5-7-11/h2-7,9-11,17,19,24H,8H2,1H3,(H3,22,25,27);10H,4-7H2,1-3H3 |
| InChIKey | BKRLXUHMRCIUFD-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 126.54 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.12 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |