C28H21N3O2 — CID 142280561
ethene;2-methyl-4-(3-pyridin-2-ylcarbazol-9-yl)isoindole-1,3-dione (PubChem CID 142280561) has the molecular formula C28H21N3O2 and a molecular weight of 431.50 g/mol. Its IUPAC name is ethene;2-methyl-4-(3-pyridin-2-ylcarbazol-9-yl)isoindole-1,3-dione.
| Compound Name | ethene;2-methyl-4-(3-pyridin-2-ylcarbazol-9-yl)isoindole-1,3-dione |
|---|---|
| PubChem CID | 142280561 |
| Molecular Formula | C28H21N3O2 |
| Molecular Weight | 431.50 g/mol |
| Exact Mass | 431.16 |
| IUPAC Name | ethene;2-methyl-4-(3-pyridin-2-ylcarbazol-9-yl)isoindole-1,3-dione |
| SMILES | C=C.CN1C(=O)c2cccc(-n3c4ccccc4c4cc(-c5ccccn5)ccc43)c2C1=O |
| InChI | InChI=1S/C26H17N3O2.C2H4/c1-28-25(30)18-8-6-11-23(24(18)26(28)31)29-21-10-3-2-7-17(21)19-15-16(12-13-22(19)29)20-9-4-5-14-27-20;1-2/h2-15H,1H3;1-2H2 |
| InChIKey | IXBAMTCMOGLICJ-UHFFFAOYSA-N |
| XLogP | 5.87 |
| TPSA | 55.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.50 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|