C36H22N4O2 — CID 158393455
4-(2,7-dipyridin-2-ylcarbazol-9-yl)-2-phenylisoindole-1,3-dione (PubChem CID 158393455) has the molecular formula C36H22N4O2 and a molecular weight of 542.60 g/mol. Its IUPAC name is 4-(2,7-dipyridin-2-ylcarbazol-9-yl)-2-phenylisoindole-1,3-dione.
| Compound Name | 4-(2,7-dipyridin-2-ylcarbazol-9-yl)-2-phenylisoindole-1,3-dione |
|---|---|
| PubChem CID | 158393455 |
| Molecular Formula | C36H22N4O2 |
| Molecular Weight | 542.60 g/mol |
| Exact Mass | 542.17 |
| IUPAC Name | 4-(2,7-dipyridin-2-ylcarbazol-9-yl)-2-phenylisoindole-1,3-dione |
| SMILES | O=C1c2cccc(-n3c4cc(-c5ccccn5)ccc4c4ccc(-c5ccccn5)cc43)c2C(=O)N1c1ccccc1 |
| InChI | InChI=1S/C36H22N4O2/c41-35-28-11-8-14-31(34(28)36(42)39(35)25-9-2-1-3-10-25)40-32-21-23(29-12-4-6-19-37-29)15-17-26(32)27-18-16-24(22-33(27)40)30-13-5-7-20-38-30/h1-22H |
| InChIKey | KKJGEQYBOFKOGG-UHFFFAOYSA-N |
| XLogP | 7.71 |
| TPSA | 68.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.60 |
| LogP ≤ 5 | 7.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|