About (3Z)-3-ethylidene-N,6-dimethylpyridin-2-imine
(3Z)-3-ethylidene-N,6-dimethylpyridin-2-imine (PubChem CID 142280961) has the molecular formula C9H12N2
and a molecular weight of 148.21 g/mol. Its IUPAC name is (3Z)-3-ethylidene-N,6-dimethylpyridin-2-imine.
Molecular Properties
| Compound Name | (3Z)-3-ethylidene-N,6-dimethylpyridin-2-imine |
| PubChem CID | 142280961 |
| Molecular Formula | C9H12N2 |
| Molecular Weight | 148.21 g/mol |
| Exact Mass | 148.10 |
| IUPAC Name | (3Z)-3-ethylidene-N,6-dimethylpyridin-2-imine |
| SMILES | C/C=C1/C=CC(C)=N/C1=N\C |
| InChI | InChI=1S/C9H12N2/c1-4-8-6-5-7(2)11-9(8)10-3/h4-6H,1-3H3/b8-4-,10-9- |
| InChIKey | ATABINTXKZANHU-LSTBLOBISA-N |
| XLogP | 1.99 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 148.21 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze (3Z)-3-ethylidene-N,6-dimethylpyridin-2-imine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3Z)-3-ethylidene-N,6-dimethylpyridin-2-imine?
The IUPAC name of (3Z)-3-ethylidene-N,6-dimethylpyridin-2-imine (CID 142280961) is (3Z)-3-ethylidene-N,6-dimethylpyridin-2-imine.
What is the SMILES notation for (3Z)-3-ethylidene-N,6-dimethylpyridin-2-imine?
The canonical SMILES for (3Z)-3-ethylidene-N,6-dimethylpyridin-2-imine is C/C=C1/C=CC(C)=N/C1=N\C.
What is the InChIKey of (3Z)-3-ethylidene-N,6-dimethylpyridin-2-imine?
The InChIKey is ATABINTXKZANHU-LSTBLOBISA-N. The full InChI is InChI=1S/C9H12N2/c1-4-8-6-5-7(2)11-9(8)10-3/h4-6H,1-3H3/b8-4-,10-9-.
What are the key properties of (3Z)-3-ethylidene-N,6-dimethylpyridin-2-imine?
(3Z)-3-ethylidene-N,6-dimethylpyridin-2-imine has a molecular weight of 148.21 g/mol, XLogP of 1.99, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (3Z)-3-ethylidene-N,6-dimethylpyridin-2-imine is sourced from PubChem (CID 142280961), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).